About 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene
2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene (PubChem CID 155395542) has the molecular formula C11H14S
and a molecular weight of 178.30 g/mol. Its IUPAC name is 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene.
Molecular Properties
| Compound Name | 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene |
| PubChem CID | 155395542 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene |
| SMILES | Cc1cc2c(s1)C=CC(C)CC2 |
| InChI | InChI=1S/C11H14S/c1-8-3-5-10-7-9(2)12-11(10)6-4-8/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | NJYNUILJFUKIHV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene?
The IUPAC name of 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene (CID 155395542) is 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene.
What is the SMILES notation for 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene?
The canonical SMILES for 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene is Cc1cc2c(s1)C=CC(C)CC2.
What is the InChIKey of 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene?
The InChIKey is NJYNUILJFUKIHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14S/c1-8-3-5-10-7-9(2)12-11(10)6-4-8/h4,6-8H,3,5H2,1-2H3.
What are the key properties of 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene?
2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene has a molecular weight of 178.30 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-5,6-dihydro-4H-cyclohepta[b]thiophene is sourced from PubChem (CID 155395542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).