About (2R)-6-chloro-2,5-dimethyl-2H-thiopyran
(2R)-6-chloro-2,5-dimethyl-2H-thiopyran (PubChem CID 155395548) has the molecular formula C7H9ClS
and a molecular weight of 160.67 g/mol. Its IUPAC name is (2R)-6-chloro-2,5-dimethyl-2H-thiopyran.
Molecular Properties
| Compound Name | (2R)-6-chloro-2,5-dimethyl-2H-thiopyran |
| PubChem CID | 155395548 |
| Molecular Formula | C7H9ClS |
| Molecular Weight | 160.67 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | (2R)-6-chloro-2,5-dimethyl-2H-thiopyran |
| SMILES | CC1=C(Cl)S[C@H](C)C=C1 |
| InChI | InChI=1S/C7H9ClS/c1-5-3-4-6(2)9-7(5)8/h3-4,6H,1-2H3/t6-/m1/s1 |
| InChIKey | UYDMFCBBHHNWMX-ZCFIWIBFSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-6-chloro-2,5-dimethyl-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-6-chloro-2,5-dimethyl-2H-thiopyran?
The IUPAC name of (2R)-6-chloro-2,5-dimethyl-2H-thiopyran (CID 155395548) is (2R)-6-chloro-2,5-dimethyl-2H-thiopyran.
What is the SMILES notation for (2R)-6-chloro-2,5-dimethyl-2H-thiopyran?
The canonical SMILES for (2R)-6-chloro-2,5-dimethyl-2H-thiopyran is CC1=C(Cl)S[C@H](C)C=C1.
What is the InChIKey of (2R)-6-chloro-2,5-dimethyl-2H-thiopyran?
The InChIKey is UYDMFCBBHHNWMX-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H9ClS/c1-5-3-4-6(2)9-7(5)8/h3-4,6H,1-2H3/t6-/m1/s1.
What are the key properties of (2R)-6-chloro-2,5-dimethyl-2H-thiopyran?
(2R)-6-chloro-2,5-dimethyl-2H-thiopyran has a molecular weight of 160.67 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6-chloro-2,5-dimethyl-2H-thiopyran is sourced from PubChem (CID 155395548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).