About N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine
N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine (PubChem CID 155395567) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine.
Molecular Properties
| Compound Name | N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine |
| PubChem CID | 155395567 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine |
| SMILES | C=C=CCC/C=N/C(C)C(C)C |
| InChI | InChI=1S/C11H19N/c1-5-6-7-8-9-12-11(4)10(2)3/h6,9-11H,1,7-8H2,2-4H3/b12-9+ |
| InChIKey | PUSQHLYIZLBKGR-FMIVXFBMSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine?
The IUPAC name of N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine (CID 155395567) is N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine.
What is the SMILES notation for N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine?
The canonical SMILES for N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine is C=C=CCC/C=N/C(C)C(C)C.
What is the InChIKey of N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine?
The InChIKey is PUSQHLYIZLBKGR-FMIVXFBMSA-N. The full InChI is InChI=1S/C11H19N/c1-5-6-7-8-9-12-11(4)10(2)3/h6,9-11H,1,7-8H2,2-4H3/b12-9+.
What are the key properties of N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine?
N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine has a molecular weight of 165.28 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylbutan-2-yl)hexa-4,5-dien-1-imine is sourced from PubChem (CID 155395567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).