C46H52N6O7S — CID 155396426
1-[5-tert-butyl-3-(methylsulfanylamino)-2-phenylphenyl]-3-[4-[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]pyrimidin-4-yl]oxynaphthalen-1-yl]urea (PubChem CID 155396426) has the molecular formula C46H52N6O7S and a molecular weight of 833.02 g/mol. Its IUPAC name is 1-[5-tert-butyl-3-(methylsulfanylamino)-2-phenylphenyl]-3-[4-[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]pyrimidin-4-yl]oxynaphthalen-1-yl]urea.
| Compound Name | 1-[5-tert-butyl-3-(methylsulfanylamino)-2-phenylphenyl]-3-[4-[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]pyrimidin-4-yl]oxynaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 155396426 |
| Molecular Formula | C46H52N6O7S |
| Molecular Weight | 833.02 g/mol |
| Exact Mass | 832.36 |
| IUPAC Name | 1-[5-tert-butyl-3-(methylsulfanylamino)-2-phenylphenyl]-3-[4-[2-[3-methoxy-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]anilino]pyrimidin-4-yl]oxynaphthalen-1-yl]urea |
| SMILES | COCCOCCOCCOc1cc(Nc2nccc(Oc3ccc(NC(=O)Nc4cc(C(C)(C)C)cc(NSC)c4-c4ccccc4)c4ccccc34)n2)cc(OC)c1 |
| InChI | InChI=1S/C46H52N6O7S/c1-46(2,3)32-26-39(43(40(27-32)52-60-6)31-12-8-7-9-13-31)50-45(53)49-38-16-17-41(37-15-11-10-14-36(37)38)59-42-18-19-47-44(51-42)48-33-28-34(55-5)30-35(29-33)58-25-24-57-23-22-56-21-20-54-4/h7-19,26-30,52H,20-25H2,1-6H3,(H,47,48,51)(H2,49,50,53) |
| InChIKey | LKEKLFJKTSEPSZ-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 146.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.02 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|