C22H20F2N6O2 — CID 155396450
(13R)-4-[[[1-[(2,4-difluorophenyl)methyl]pyrazol-4-yl]amino]-hydroxymethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one (PubChem CID 155396450) has the molecular formula C22H20F2N6O2 and a molecular weight of 438.44 g/mol. Its IUPAC name is (13R)-4-[[[1-[(2,4-difluorophenyl)methyl]pyrazol-4-yl]amino]-hydroxymethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one.
| Compound Name | (13R)-4-[[[1-[(2,4-difluorophenyl)methyl]pyrazol-4-yl]amino]-hydroxymethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one |
|---|---|
| PubChem CID | 155396450 |
| Molecular Formula | C22H20F2N6O2 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (13R)-4-[[[1-[(2,4-difluorophenyl)methyl]pyrazol-4-yl]amino]-hydroxymethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one |
| SMILES | C[C@@H]1CNC(=O)c2cc3ccc(C(O)Nc4cnn(Cc5ccc(F)cc5F)c4)nc3n21 |
| InChI | InChI=1S/C22H20F2N6O2/c1-12-8-25-22(32)19-6-13-3-5-18(28-20(13)30(12)19)21(31)27-16-9-26-29(11-16)10-14-2-4-15(23)7-17(14)24/h2-7,9,11-12,21,27,31H,8,10H2,1H3,(H,25,32)/t12-,21?/m1/s1 |
| InChIKey | DDZXWWGGWMZRKW-FXADVQPWSA-N |
| XLogP | 2.97 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|