About 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one
8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 155396955) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one |
| PubChem CID | 155396955 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | CC(C)(C)N1CCC2(CC1)COC(=O)N2 |
| InChI | InChI=1S/C11H20N2O2/c1-10(2,3)13-6-4-11(5-7-13)8-15-9(14)12-11/h4-8H2,1-3H3,(H,12,14) |
| InChIKey | IBIGJGUWEXDJKL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one?
The IUPAC name of 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one (CID 155396955) is 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one.
What is the SMILES notation for 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one?
The canonical SMILES for 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one is CC(C)(C)N1CCC2(CC1)COC(=O)N2.
What is the InChIKey of 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one?
The InChIKey is IBIGJGUWEXDJKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-10(2,3)13-6-4-11(5-7-13)8-15-9(14)12-11/h4-8H2,1-3H3,(H,12,14).
What are the key properties of 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one?
8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one has a molecular weight of 212.29 g/mol, XLogP of 1.36, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-3-oxa-1,8-diazaspiro[4.5]decan-2-one is sourced from PubChem (CID 155396955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).