C37H39F4N3O6 — CID 155397006
ethyl 2-amino-8-[3-[[3-[3,3-dimethyl-4-oxo-4-(2,3,5,6-tetrafluorophenoxy)butoxy]-3-methylbutyl]carbamoyl]phenyl]-3H-1-benzazepine-4-carboxylate (PubChem CID 155397006) has the molecular formula C37H39F4N3O6 and a molecular weight of 697.73 g/mol. Its IUPAC name is ethyl 2-amino-8-[3-[[3-[3,3-dimethyl-4-oxo-4-(2,3,5,6-tetrafluorophenoxy)butoxy]-3-methylbutyl]carbamoyl]phenyl]-3H-1-benzazepine-4-carboxylate.
| Compound Name | ethyl 2-amino-8-[3-[[3-[3,3-dimethyl-4-oxo-4-(2,3,5,6-tetrafluorophenoxy)butoxy]-3-methylbutyl]carbamoyl]phenyl]-3H-1-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 155397006 |
| Molecular Formula | C37H39F4N3O6 |
| Molecular Weight | 697.73 g/mol |
| Exact Mass | 697.28 |
| IUPAC Name | ethyl 2-amino-8-[3-[[3-[3,3-dimethyl-4-oxo-4-(2,3,5,6-tetrafluorophenoxy)butoxy]-3-methylbutyl]carbamoyl]phenyl]-3H-1-benzazepine-4-carboxylate |
| SMILES | CCOC(=O)C1=Cc2ccc(-c3cccc(C(=O)NCCC(C)(C)OCCC(C)(C)C(=O)Oc4c(F)c(F)cc(F)c4F)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C37H39F4N3O6/c1-6-48-34(46)25-17-23-11-10-22(18-28(23)44-29(42)19-25)21-8-7-9-24(16-21)33(45)43-14-12-37(4,5)49-15-13-36(2,3)35(47)50-32-30(40)26(38)20-27(39)31(32)41/h7-11,16-18,20H,6,12-15,19H2,1-5H3,(H2,42,44)(H,43,45) |
| InChIKey | FMWVQRXGOPLAEX-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|