C38H52S — CID 155397113
[4-(3,5-ditert-butylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-λ4-sulfane (PubChem CID 155397113) has the molecular formula C38H52S and a molecular weight of 540.90 g/mol. Its IUPAC name is [4-(3,5-ditert-butylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-λ4-sulfane.
| Compound Name | [4-(3,5-ditert-butylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-λ4-sulfane |
|---|---|
| PubChem CID | 155397113 |
| Molecular Formula | C38H52S |
| Molecular Weight | 540.90 g/mol |
| Exact Mass | 540.38 |
| IUPAC Name | [4-(3,5-ditert-butylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-λ4-sulfane |
| SMILES | CC1=Cc2c(cc3c(c2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)CCC3)C1S(C)(C)C1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C38H52S/c1-22-17-32-33(35(22)39(12,13)36-25(4)23(2)24(3)26(36)5)20-27-15-14-16-31(27)34(32)28-18-29(37(6,7)8)21-30(19-28)38(9,10)11/h17-21,35-36H,14-16H2,1-13H3 |
| InChIKey | KHLMJFWWJQAZPP-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.90 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |