C23H27NO — CID 155398919
(3E,4E)-3-ethylidene-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-prop-2-enylidenepyrrolidin-2-one (PubChem CID 155398919) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (3E,4E)-3-ethylidene-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-prop-2-enylidenepyrrolidin-2-one.
| Compound Name | (3E,4E)-3-ethylidene-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-prop-2-enylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 155398919 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (3E,4E)-3-ethylidene-5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-prop-2-enylidenepyrrolidin-2-one |
| SMILES | C=C/C=C\C(=C/C)C1(/C(C=C)=C/C=C\C)NC(=O)C(=C/C)/C1=C\C=C |
| InChI | InChI=1S/C23H27NO/c1-7-13-16-18(10-4)23(19(11-5)17-14-8-2)21(15-9-3)20(12-6)22(25)24-23/h7-17H,1,3,5H2,2,4,6H3,(H,24,25)/b14-8-,16-13-,18-10+,19-17+,20-12+,21-15+ |
| InChIKey | MRCPSVTZUXEVPM-LGLDIWPXSA-N |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|