About 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole
8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 155399075) has the molecular formula C12H11BrClN
and a molecular weight of 284.58 g/mol. Its IUPAC name is 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole.
Molecular Properties
| Compound Name | 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole |
| PubChem CID | 155399075 |
| Molecular Formula | C12H11BrClN |
| Molecular Weight | 284.58 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | Clc1ccc(Br)c2[nH]c3c(c12)CCCC3 |
| InChI | InChI=1S/C12H11BrClN/c13-8-5-6-9(14)11-7-3-1-2-4-10(7)15-12(8)11/h5-6,15H,1-4H2 |
| InChIKey | RMVCUWPIKJYQMQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole?
The IUPAC name of 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole (CID 155399075) is 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole.
What is the SMILES notation for 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole?
The canonical SMILES for 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole is Clc1ccc(Br)c2[nH]c3c(c12)CCCC3.
What is the InChIKey of 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole?
The InChIKey is RMVCUWPIKJYQMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrClN/c13-8-5-6-9(14)11-7-3-1-2-4-10(7)15-12(8)11/h5-6,15H,1-4H2.
What are the key properties of 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole?
8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole has a molecular weight of 284.58 g/mol, XLogP of 4.46, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-chloro-2,3,4,9-tetrahydro-1H-carbazole is sourced from PubChem (CID 155399075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).