C12H9BrFNO3 — CID 155399387
10-bromo-7-fluoro-6-methyl-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione (PubChem CID 155399387) has the molecular formula C12H9BrFNO3 and a molecular weight of 314.11 g/mol. Its IUPAC name is 10-bromo-7-fluoro-6-methyl-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione.
| Compound Name | 10-bromo-7-fluoro-6-methyl-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione |
|---|---|
| PubChem CID | 155399387 |
| Molecular Formula | C12H9BrFNO3 |
| Molecular Weight | 314.11 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 10-bromo-7-fluoro-6-methyl-6,10b-dihydro-5H-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione |
| SMILES | CC1CN2C(=O)C(=O)OC2c2c(Br)ccc(F)c21 |
| InChI | InChI=1S/C12H9BrFNO3/c1-5-4-15-10(16)12(17)18-11(15)9-6(13)2-3-7(14)8(5)9/h2-3,5,11H,4H2,1H3 |
| InChIKey | JEXCNEPCACDEAL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.11 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|