C17H10F4N4S — CID 155399972
1-[(6-fluoro-3-pyridinyl)methyl]-6-[5-(trifluoromethyl)thiophen-2-yl]pyrazolo[4,5-b]pyridine (PubChem CID 155399972) has the molecular formula C17H10F4N4S and a molecular weight of 378.35 g/mol. Its IUPAC name is 1-[(6-fluoro-3-pyridinyl)methyl]-6-[5-(trifluoromethyl)thiophen-2-yl]pyrazolo[4,5-b]pyridine.
| Compound Name | 1-[(6-fluoro-3-pyridinyl)methyl]-6-[5-(trifluoromethyl)thiophen-2-yl]pyrazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 155399972 |
| Molecular Formula | C17H10F4N4S |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1-[(6-fluoro-3-pyridinyl)methyl]-6-[5-(trifluoromethyl)thiophen-2-yl]pyrazolo[4,5-b]pyridine |
| SMILES | Fc1ccc(Cn2ncc3ncc(-c4ccc(C(F)(F)F)s4)cc32)cn1 |
| InChI | InChI=1S/C17H10F4N4S/c18-16-4-1-10(6-23-16)9-25-13-5-11(7-22-12(13)8-24-25)14-2-3-15(26-14)17(19,20)21/h1-8H,9H2 |
| InChIKey | WCZNFQUFYVEIJE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|