C31H31NO7 — CID 155400176
methyl (2R,3S,3aR,8bR)-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-8b-(prop-2-enylamino)-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxylate (PubChem CID 155400176) has the molecular formula C31H31NO7 and a molecular weight of 529.59 g/mol. Its IUPAC name is methyl (2R,3S,3aR,8bR)-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-8b-(prop-2-enylamino)-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxylate.
| Compound Name | methyl (2R,3S,3aR,8bR)-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-8b-(prop-2-enylamino)-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 155400176 |
| Molecular Formula | C31H31NO7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | methyl (2R,3S,3aR,8bR)-6,8-dimethoxy-3a-(4-methoxyphenyl)-1-oxo-3-phenyl-8b-(prop-2-enylamino)-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxylate |
| SMILES | C=CCN[C@@]12C(=O)[C@H](C(=O)OC)[C@@H](c3ccccc3)[C@]1(c1ccc(OC)cc1)Oc1cc(OC)cc(OC)c12 |
| InChI | InChI=1S/C31H31NO7/c1-6-16-32-30-27-23(37-4)17-22(36-3)18-24(27)39-31(30,20-12-14-21(35-2)15-13-20)26(19-10-8-7-9-11-19)25(28(30)33)29(34)38-5/h6-15,17-18,25-26,32H,1,16H2,2-5H3/t25-,26-,30+,31+/m1/s1 |
| InChIKey | SDPSCWKIAYCMBD-GJVGYNRESA-N |
| XLogP | 4.13 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|