C22H30Cl2N2O4S — CID 155400303
5-chloro-2-(chloromethyl)-1-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]propyl]benzimidazole (PubChem CID 155400303) has the molecular formula C22H30Cl2N2O4S and a molecular weight of 489.47 g/mol. Its IUPAC name is 5-chloro-2-(chloromethyl)-1-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]propyl]benzimidazole.
| Compound Name | 5-chloro-2-(chloromethyl)-1-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]propyl]benzimidazole |
|---|---|
| PubChem CID | 155400303 |
| Molecular Formula | C22H30Cl2N2O4S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 5-chloro-2-(chloromethyl)-1-[3-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]propyl]benzimidazole |
| SMILES | C#CCOCCOCCOCCOCCSCCCn1c(CCl)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H30Cl2N2O4S/c1-2-7-27-8-9-28-10-11-29-12-13-30-14-16-31-15-3-6-26-21-5-4-19(24)17-20(21)25-22(26)18-23/h1,4-5,17H,3,6-16,18H2 |
| InChIKey | DQFZZRBGWUBHQN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|