C10H23N3O — CID 155400358
5-[amino(methyl)amino]-2,2,4,4-tetramethylpentanamide (PubChem CID 155400358) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 5-[amino(methyl)amino]-2,2,4,4-tetramethylpentanamide.
| Compound Name | 5-[amino(methyl)amino]-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 155400358 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 5-[amino(methyl)amino]-2,2,4,4-tetramethylpentanamide |
| SMILES | CN(N)CC(C)(C)CC(C)(C)C(N)=O |
| InChI | InChI=1S/C10H23N3O/c1-9(2,7-13(5)12)6-10(3,4)8(11)14/h6-7,12H2,1-5H3,(H2,11,14) |
| InChIKey | KCLFFWDRYFEUGO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|