About 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene
3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene (PubChem CID 155400752) has the molecular formula C11H17FS
and a molecular weight of 200.32 g/mol. Its IUPAC name is 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene.
Molecular Properties
| Compound Name | 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene |
| PubChem CID | 155400752 |
| Molecular Formula | C11H17FS |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene |
| SMILES | Cc1c(C(C)C)sc(C(C)C)c1F |
| InChI | InChI=1S/C11H17FS/c1-6(2)10-8(5)9(12)11(13-10)7(3)4/h6-7H,1-5H3 |
| InChIKey | YEVBRDIZXBGITO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene?
The IUPAC name of 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene (CID 155400752) is 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene.
What is the SMILES notation for 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene?
The canonical SMILES for 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene is Cc1c(C(C)C)sc(C(C)C)c1F.
What is the InChIKey of 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene?
The InChIKey is YEVBRDIZXBGITO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FS/c1-6(2)10-8(5)9(12)11(13-10)7(3)4/h6-7H,1-5H3.
What are the key properties of 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene?
3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene has a molecular weight of 200.32 g/mol, XLogP of 4.44, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-methyl-2,5-di(propan-2-yl)thiophene is sourced from PubChem (CID 155400752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).