C15H18I3NO5S — CID 155401425
4-[hydroxy-(2,3,5-triiodophenyl)methoxy]-N-methylsulfonylcyclohexane-1-carboxamide (PubChem CID 155401425) has the molecular formula C15H18I3NO5S and a molecular weight of 705.09 g/mol. Its IUPAC name is 4-[hydroxy-(2,3,5-triiodophenyl)methoxy]-N-methylsulfonylcyclohexane-1-carboxamide.
| Compound Name | 4-[hydroxy-(2,3,5-triiodophenyl)methoxy]-N-methylsulfonylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 155401425 |
| Molecular Formula | C15H18I3NO5S |
| Molecular Weight | 705.09 g/mol |
| Exact Mass | 704.80 |
| IUPAC Name | 4-[hydroxy-(2,3,5-triiodophenyl)methoxy]-N-methylsulfonylcyclohexane-1-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)C1CCC(OC(O)c2cc(I)cc(I)c2I)CC1 |
| InChI | InChI=1S/C15H18I3NO5S/c1-25(22,23)19-14(20)8-2-4-10(5-3-8)24-15(21)11-6-9(16)7-12(17)13(11)18/h6-8,10,15,21H,2-5H2,1H3,(H,19,20) |
| InChIKey | DBOSNNRLVGXMJQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|