C16H22F4O2 — CID 155401772
8-(1,1,2,2-tetrafluoropropyl)spiro[3,5-dioxatricyclo[5.2.1.02,6]decane-4,1'-cyclohexane] (PubChem CID 155401772) has the molecular formula C16H22F4O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 8-(1,1,2,2-tetrafluoropropyl)spiro[3,5-dioxatricyclo[5.2.1.02,6]decane-4,1'-cyclohexane].
| Compound Name | 8-(1,1,2,2-tetrafluoropropyl)spiro[3,5-dioxatricyclo[5.2.1.02,6]decane-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 155401772 |
| Molecular Formula | C16H22F4O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 8-(1,1,2,2-tetrafluoropropyl)spiro[3,5-dioxatricyclo[5.2.1.02,6]decane-4,1'-cyclohexane] |
| SMILES | CC(F)(F)C(F)(F)C1CC2CC1C1OC3(CCCCC3)OC21 |
| InChI | InChI=1S/C16H22F4O2/c1-14(17,18)16(19,20)11-8-9-7-10(11)13-12(9)21-15(22-13)5-3-2-4-6-15/h9-13H,2-8H2,1H3 |
| InChIKey | ITEUBOAZBJDQSE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|