C10H16F4 — CID 155402389
(E)-3-ethyl-1,1,1,2-tetrafluoro-6-methylhept-2-ene (PubChem CID 155402389) has the molecular formula C10H16F4 and a molecular weight of 212.23 g/mol. Its IUPAC name is (E)-3-ethyl-1,1,1,2-tetrafluoro-6-methylhept-2-ene.
| Compound Name | (E)-3-ethyl-1,1,1,2-tetrafluoro-6-methylhept-2-ene |
|---|---|
| PubChem CID | 155402389 |
| Molecular Formula | C10H16F4 |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (E)-3-ethyl-1,1,1,2-tetrafluoro-6-methylhept-2-ene |
| SMILES | CC/C(CCC(C)C)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C10H16F4/c1-4-8(6-5-7(2)3)9(11)10(12,13)14/h7H,4-6H2,1-3H3/b9-8+ |
| InChIKey | MHQCSIHLAPSHDN-CMDGGOBGSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |