C18H35NO — CID 155402658
(3E)-2,8-diethyl-3-(methoxymethyl)-N,N-dimethyldeca-3,7-dien-1-amine (PubChem CID 155402658) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is (3E)-2,8-diethyl-3-(methoxymethyl)-N,N-dimethyldeca-3,7-dien-1-amine.
| Compound Name | (3E)-2,8-diethyl-3-(methoxymethyl)-N,N-dimethyldeca-3,7-dien-1-amine |
|---|---|
| PubChem CID | 155402658 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | (3E)-2,8-diethyl-3-(methoxymethyl)-N,N-dimethyldeca-3,7-dien-1-amine |
| SMILES | CCC(=CCC/C=C(/COC)C(CC)CN(C)C)CC |
| InChI | InChI=1S/C18H35NO/c1-7-16(8-2)12-10-11-13-18(15-20-6)17(9-3)14-19(4)5/h12-13,17H,7-11,14-15H2,1-6H3/b18-13- |
| InChIKey | SNXMVRUVDRKRRZ-AQTBWJFISA-N |
| XLogP | 4.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|