C8H11NO — CID 155402728
(7aR)-2,3,7,7a-tetrahydro-1-benzofuran-2-amine (PubChem CID 155402728) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (7aR)-2,3,7,7a-tetrahydro-1-benzofuran-2-amine.
| Compound Name | (7aR)-2,3,7,7a-tetrahydro-1-benzofuran-2-amine |
|---|---|
| PubChem CID | 155402728 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (7aR)-2,3,7,7a-tetrahydro-1-benzofuran-2-amine |
| SMILES | NC1CC2=CC=CC[C@H]2O1 |
| InChI | InChI=1S/C8H11NO/c9-8-5-6-3-1-2-4-7(6)10-8/h1-3,7-8H,4-5,9H2/t7-,8?/m1/s1 |
| InChIKey | NBQHRWGTNZZTLT-GVHYBUMESA-N |
| XLogP | 0.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |