C9H12IN — CID 155402756
(4aR)-7-iodo-4a,5,6,7,8,8a-hexahydroquinoline (PubChem CID 155402756) has the molecular formula C9H12IN and a molecular weight of 261.11 g/mol. Its IUPAC name is (4aR)-7-iodo-4a,5,6,7,8,8a-hexahydroquinoline.
| Compound Name | (4aR)-7-iodo-4a,5,6,7,8,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 155402756 |
| Molecular Formula | C9H12IN |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | (4aR)-7-iodo-4a,5,6,7,8,8a-hexahydroquinoline |
| SMILES | IC1CC[C@@H]2C=CC=NC2C1 |
| InChI | InChI=1S/C9H12IN/c10-8-4-3-7-2-1-5-11-9(7)6-8/h1-2,5,7-9H,3-4,6H2/t7-,8?,9?/m0/s1 |
| InChIKey | NVMWNGJUYYYPBY-UEJVZZJDSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|