C9H14N2 — CID 155402757
2-methyl-1,3a,4,5,8,8a-hexahydropyrrolo[2,3-c]azepine (PubChem CID 155402757) has the molecular formula C9H14N2 and a molecular weight of 150.23 g/mol. Its IUPAC name is 2-methyl-1,3a,4,5,8,8a-hexahydropyrrolo[2,3-c]azepine.
| Compound Name | 2-methyl-1,3a,4,5,8,8a-hexahydropyrrolo[2,3-c]azepine |
|---|---|
| PubChem CID | 155402757 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-methyl-1,3a,4,5,8,8a-hexahydropyrrolo[2,3-c]azepine |
| SMILES | CC1=CC2CCC=NCC2N1 |
| InChI | InChI=1S/C9H14N2/c1-7-5-8-3-2-4-10-6-9(8)11-7/h4-5,8-9,11H,2-3,6H2,1H3 |
| InChIKey | MLRJUGFUWXTHOF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |