C11H18N2 — CID 155402781
N,N,4-trimethyl-7-(methylideneamino)cyclohepta-1,5-dien-1-amine (PubChem CID 155402781) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N,N,4-trimethyl-7-(methylideneamino)cyclohepta-1,5-dien-1-amine.
| Compound Name | N,N,4-trimethyl-7-(methylideneamino)cyclohepta-1,5-dien-1-amine |
|---|---|
| PubChem CID | 155402781 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N,N,4-trimethyl-7-(methylideneamino)cyclohepta-1,5-dien-1-amine |
| SMILES | C=NC1C=CC(C)CC=C1N(C)C |
| InChI | InChI=1S/C11H18N2/c1-9-5-7-10(12-2)11(8-6-9)13(3)4/h5,7-10H,2,6H2,1,3-4H3 |
| InChIKey | BCMCGPRLQKZCEN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|