C20H30N4O — CID 155402796
2-(2-azabicyclo[2.2.2]octan-2-yl)-N-[6-(4-methylpiperidin-1-yl)-3-pyridinyl]acetamide (PubChem CID 155402796) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 2-(2-azabicyclo[2.2.2]octan-2-yl)-N-[6-(4-methylpiperidin-1-yl)-3-pyridinyl]acetamide.
| Compound Name | 2-(2-azabicyclo[2.2.2]octan-2-yl)-N-[6-(4-methylpiperidin-1-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 155402796 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2-(2-azabicyclo[2.2.2]octan-2-yl)-N-[6-(4-methylpiperidin-1-yl)-3-pyridinyl]acetamide |
| SMILES | CC1CCN(c2ccc(NC(=O)CN3CC4CCC3CC4)cn2)CC1 |
| InChI | InChI=1S/C20H30N4O/c1-15-8-10-23(11-9-15)19-7-4-17(12-21-19)22-20(25)14-24-13-16-2-5-18(24)6-3-16/h4,7,12,15-16,18H,2-3,5-6,8-11,13-14H2,1H3,(H,22,25) |
| InChIKey | VOCXFTFDDGSGHH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |