C44H29N3O2 — CID 155402925
N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-4-(4-phenylphenyl)aniline (PubChem CID 155402925) has the molecular formula C44H29N3O2 and a molecular weight of 631.74 g/mol. Its IUPAC name is N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-4-(4-phenylphenyl)aniline.
| Compound Name | N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-4-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 155402925 |
| Molecular Formula | C44H29N3O2 |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-4-(4-phenylphenyl)aniline |
| SMILES | c1ccc(-c2ccc(-c3ccc(N(c4ccc(-c5nc6ccccc6o5)cc4)c4ccc(-c5nc6ccccc6o5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H29N3O2/c1-2-8-30(9-3-1)31-14-16-32(17-15-31)33-18-24-36(25-19-33)47(37-26-20-34(21-27-37)43-45-39-10-4-6-12-41(39)48-43)38-28-22-35(23-29-38)44-46-40-11-5-7-13-42(40)49-44/h1-29H |
| InChIKey | SNSWTIVNPOVFEP-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 55.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |