C16H28FNS — CID 155402945
(4E)-4-[(2E)-2-ethyl-3-fluoropenta-2,4-dienylidene]-1,1,2,3,5-pentamethyl-1,3-thiazinane (PubChem CID 155402945) has the molecular formula C16H28FNS and a molecular weight of 285.47 g/mol. Its IUPAC name is (4E)-4-[(2E)-2-ethyl-3-fluoropenta-2,4-dienylidene]-1,1,2,3,5-pentamethyl-1,3-thiazinane.
| Compound Name | (4E)-4-[(2E)-2-ethyl-3-fluoropenta-2,4-dienylidene]-1,1,2,3,5-pentamethyl-1,3-thiazinane |
|---|---|
| PubChem CID | 155402945 |
| Molecular Formula | C16H28FNS |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (4E)-4-[(2E)-2-ethyl-3-fluoropenta-2,4-dienylidene]-1,1,2,3,5-pentamethyl-1,3-thiazinane |
| SMILES | C=C/C(F)=C(\C=C1/C(C)CS(C)(C)C(C)N1C)CC |
| InChI | InChI=1S/C16H28FNS/c1-8-14(15(17)9-2)10-16-12(3)11-19(6,7)13(4)18(16)5/h9-10,12-13H,2,8,11H2,1,3-7H3/b15-14+,16-10+ |
| InChIKey | BVWFCXTXANJYGM-AYCNDHBZSA-N |
| XLogP | 4.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|