About 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione
6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione (PubChem CID 155402952) has the molecular formula C8H9NS2
and a molecular weight of 183.30 g/mol. Its IUPAC name is 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione.
Molecular Properties
| Compound Name | 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione |
| PubChem CID | 155402952 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione |
| SMILES | CN1C=CC2C=CSC2C1=S |
| InChI | InChI=1S/C8H9NS2/c1-9-4-2-6-3-5-11-7(6)8(9)10/h2-7H,1H3 |
| InChIKey | HQKZXBOBPWOQEY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione?
The IUPAC name of 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione (CID 155402952) is 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione.
What is the SMILES notation for 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione?
The canonical SMILES for 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione is CN1C=CC2C=CSC2C1=S.
What is the InChIKey of 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione?
The InChIKey is HQKZXBOBPWOQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS2/c1-9-4-2-6-3-5-11-7(6)8(9)10/h2-7H,1H3.
What are the key properties of 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione?
6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione has a molecular weight of 183.30 g/mol, XLogP of 2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3a,7a-dihydrothieno[2,3-c]pyridine-7-thione is sourced from PubChem (CID 155402952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).