C28H43N — CID 155402969
2,7-ditert-butyl-9-(2-cyclopentylpropan-2-yl)-3,4,4a,9-tetrahydro-2H-indeno[2,1-b]pyridine (PubChem CID 155402969) has the molecular formula C28H43N and a molecular weight of 393.66 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-(2-cyclopentylpropan-2-yl)-3,4,4a,9-tetrahydro-2H-indeno[2,1-b]pyridine.
| Compound Name | 2,7-ditert-butyl-9-(2-cyclopentylpropan-2-yl)-3,4,4a,9-tetrahydro-2H-indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 155402969 |
| Molecular Formula | C28H43N |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | 2,7-ditert-butyl-9-(2-cyclopentylpropan-2-yl)-3,4,4a,9-tetrahydro-2H-indeno[2,1-b]pyridine |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C(C)(C)C1CCCC1)C1=NC(C(C)(C)C)CCC12 |
| InChI | InChI=1S/C28H43N/c1-26(2,3)19-13-14-20-21-15-16-23(27(4,5)6)29-25(21)24(22(20)17-19)28(7,8)18-11-9-10-12-18/h13-14,17-18,21,23-24H,9-12,15-16H2,1-8H3 |
| InChIKey | ZRSKNFPRXGGQGC-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |