About 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine
3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine (PubChem CID 155402986) has the molecular formula C12H18ClNO
and a molecular weight of 227.73 g/mol. Its IUPAC name is 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine.
Molecular Properties
| Compound Name | 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine |
| PubChem CID | 155402986 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine |
| SMILES | CNC1=CC(Cl)=CCC=C1OCC(C)C |
| InChI | InChI=1S/C12H18ClNO/c1-9(2)8-15-12-6-4-5-10(13)7-11(12)14-3/h5-7,9,14H,4,8H2,1-3H3 |
| InChIKey | MIMMJJZHWOPESR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine?
The IUPAC name of 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine (CID 155402986) is 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine.
What is the SMILES notation for 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine?
The canonical SMILES for 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine is CNC1=CC(Cl)=CCC=C1OCC(C)C.
What is the InChIKey of 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine?
The InChIKey is MIMMJJZHWOPESR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClNO/c1-9(2)8-15-12-6-4-5-10(13)7-11(12)14-3/h5-7,9,14H,4,8H2,1-3H3.
What are the key properties of 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine?
3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine has a molecular weight of 227.73 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-methyl-7-(2-methylpropoxy)cyclohepta-1,3,6-trien-1-amine is sourced from PubChem (CID 155402986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).