C23H30Cl2N6S — CID 155403171
2-[(1R,5S)-6-amino-3-azabicyclo[3.1.0]hexan-3-yl]-6-(2,3-dichlorophenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine (PubChem CID 155403171) has the molecular formula C23H30Cl2N6S and a molecular weight of 493.51 g/mol. Its IUPAC name is 2-[(1R,5S)-6-amino-3-azabicyclo[3.1.0]hexan-3-yl]-6-(2,3-dichlorophenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine.
| Compound Name | 2-[(1R,5S)-6-amino-3-azabicyclo[3.1.0]hexan-3-yl]-6-(2,3-dichlorophenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine |
|---|---|
| PubChem CID | 155403171 |
| Molecular Formula | C23H30Cl2N6S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-[(1R,5S)-6-amino-3-azabicyclo[3.1.0]hexan-3-yl]-6-(2,3-dichlorophenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2cccc(Cl)c2Cl)nc2sc(N3C[C@@H]4C(N)[C@@H]4C3)nn12 |
| InChI | InChI=1S/C23H30Cl2N6S/c1-22(2,3)11-23(4,5)28-19-18(12-7-6-8-15(24)16(12)25)27-20-31(19)29-21(32-20)30-9-13-14(10-30)17(13)26/h6-8,13-14,17,28H,9-11,26H2,1-5H3/t13-,14+,17? |
| InChIKey | TVRVGBLDXPQVQT-VMZNBEPHSA-N |
| XLogP | 5.78 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |