About 7,8-ditert-butylpyrido[3,2-d]pyrimidine
7,8-ditert-butylpyrido[3,2-d]pyrimidine (PubChem CID 155403628) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 7,8-ditert-butylpyrido[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 7,8-ditert-butylpyrido[3,2-d]pyrimidine |
| PubChem CID | 155403628 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 7,8-ditert-butylpyrido[3,2-d]pyrimidine |
| SMILES | CC(C)(C)c1cnc2cncnc2c1C(C)(C)C |
| InChI | InChI=1S/C15H21N3/c1-14(2,3)10-7-17-11-8-16-9-18-13(11)12(10)15(4,5)6/h7-9H,1-6H3 |
| InChIKey | BHBINMOXVBZIAX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-ditert-butylpyrido[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-ditert-butylpyrido[3,2-d]pyrimidine?
The IUPAC name of 7,8-ditert-butylpyrido[3,2-d]pyrimidine (CID 155403628) is 7,8-ditert-butylpyrido[3,2-d]pyrimidine.
What is the SMILES notation for 7,8-ditert-butylpyrido[3,2-d]pyrimidine?
The canonical SMILES for 7,8-ditert-butylpyrido[3,2-d]pyrimidine is CC(C)(C)c1cnc2cncnc2c1C(C)(C)C.
What is the InChIKey of 7,8-ditert-butylpyrido[3,2-d]pyrimidine?
The InChIKey is BHBINMOXVBZIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3/c1-14(2,3)10-7-17-11-8-16-9-18-13(11)12(10)15(4,5)6/h7-9H,1-6H3.
What are the key properties of 7,8-ditert-butylpyrido[3,2-d]pyrimidine?
7,8-ditert-butylpyrido[3,2-d]pyrimidine has a molecular weight of 243.35 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-ditert-butylpyrido[3,2-d]pyrimidine is sourced from PubChem (CID 155403628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).