C15H24N2 — CID 155403670
6,7-ditert-butyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine (PubChem CID 155403670) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 6,7-ditert-butyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 6,7-ditert-butyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 155403670 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 6,7-ditert-butyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine |
| SMILES | CC(C)(C)c1ncc2c(c1C(C)(C)C)NCC2 |
| InChI | InChI=1S/C15H24N2/c1-14(2,3)11-12-10(7-8-16-12)9-17-13(11)15(4,5)6/h9,16H,7-8H2,1-6H3 |
| InChIKey | HKDAJEAVAFBUSR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |