C14H22N2 — CID 155403712
4,5-ditert-butyl-1,6-dihydropyrrolo[2,3-b]pyrrole (PubChem CID 155403712) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 4,5-ditert-butyl-1,6-dihydropyrrolo[2,3-b]pyrrole.
| Compound Name | 4,5-ditert-butyl-1,6-dihydropyrrolo[2,3-b]pyrrole |
|---|---|
| PubChem CID | 155403712 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4,5-ditert-butyl-1,6-dihydropyrrolo[2,3-b]pyrrole |
| SMILES | CC(C)(C)c1[nH]c2[nH]ccc2c1C(C)(C)C |
| InChI | InChI=1S/C14H22N2/c1-13(2,3)10-9-7-8-15-12(9)16-11(10)14(4,5)6/h7-8,15-16H,1-6H3 |
| InChIKey | TYVACAMLLSIOBI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |