C22H12Cl2N2S — CID 155403715
2,6-dichloro-4-(4-phenylphenyl)-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 155403715) has the molecular formula C22H12Cl2N2S and a molecular weight of 407.33 g/mol. Its IUPAC name is 2,6-dichloro-4-(4-phenylphenyl)-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 2,6-dichloro-4-(4-phenylphenyl)-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155403715 |
| Molecular Formula | C22H12Cl2N2S |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 2,6-dichloro-4-(4-phenylphenyl)-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | Clc1nc(-c2ccc(-c3ccccc3)cc2)c2sc3c(Cl)cccc3c2n1 |
| InChI | InChI=1S/C22H12Cl2N2S/c23-17-8-4-7-16-19-21(27-20(16)17)18(25-22(24)26-19)15-11-9-14(10-12-15)13-5-2-1-3-6-13/h1-12H |
| InChIKey | KFZORFXJAOJSHK-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |