About 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine
7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine (PubChem CID 155403852) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine |
| PubChem CID | 155403852 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine |
| SMILES | CC(C)(C)C1=CC2=CN=CCN2C=C1C(C)(C)C |
| InChI | InChI=1S/C16H24N2/c1-15(2,3)13-9-12-10-17-7-8-18(12)11-14(13)16(4,5)6/h7,9-11H,8H2,1-6H3 |
| InChIKey | IYJYGABPACWKCS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine?
The IUPAC name of 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine (CID 155403852) is 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine.
What is the SMILES notation for 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine?
The canonical SMILES for 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine is CC(C)(C)C1=CC2=CN=CCN2C=C1C(C)(C)C.
What is the InChIKey of 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine?
The InChIKey is IYJYGABPACWKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2/c1-15(2,3)13-9-12-10-17-7-8-18(12)11-14(13)16(4,5)6/h7,9-11H,8H2,1-6H3.
What are the key properties of 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine?
7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine has a molecular weight of 244.38 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-ditert-butyl-4H-pyrido[1,2-a]pyrazine is sourced from PubChem (CID 155403852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).