About 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine
3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine (PubChem CID 155403873) has the molecular formula C11H19NS
and a molecular weight of 197.35 g/mol. Its IUPAC name is 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine.
Molecular Properties
| Compound Name | 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine |
| PubChem CID | 155403873 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine |
| SMILES | CC(C)C1=C(C(C)(C)C)NC=CS1 |
| InChI | InChI=1S/C11H19NS/c1-8(2)9-10(11(3,4)5)12-6-7-13-9/h6-8,12H,1-5H3 |
| InChIKey | DQKPMVQGWHEDOL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine?
The IUPAC name of 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine (CID 155403873) is 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine.
What is the SMILES notation for 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine?
The canonical SMILES for 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine is CC(C)C1=C(C(C)(C)C)NC=CS1.
What is the InChIKey of 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine?
The InChIKey is DQKPMVQGWHEDOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NS/c1-8(2)9-10(11(3,4)5)12-6-7-13-9/h6-8,12H,1-5H3.
What are the key properties of 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine?
3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine has a molecular weight of 197.35 g/mol, XLogP of 3.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2-propan-2-yl-4H-1,4-thiazine is sourced from PubChem (CID 155403873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).