About 3,4-ditert-butyl-1,2-dihydroisoquinoline
3,4-ditert-butyl-1,2-dihydroisoquinoline (PubChem CID 155403912) has the molecular formula C17H25N
and a molecular weight of 243.39 g/mol. Its IUPAC name is 3,4-ditert-butyl-1,2-dihydroisoquinoline.
Molecular Properties
| Compound Name | 3,4-ditert-butyl-1,2-dihydroisoquinoline |
| PubChem CID | 155403912 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 3,4-ditert-butyl-1,2-dihydroisoquinoline |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)c2ccccc2CN1 |
| InChI | InChI=1S/C17H25N/c1-16(2,3)14-13-10-8-7-9-12(13)11-18-15(14)17(4,5)6/h7-10,18H,11H2,1-6H3 |
| InChIKey | ZYVBMRYSYLGAJD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-ditert-butyl-1,2-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butyl-1,2-dihydroisoquinoline?
The IUPAC name of 3,4-ditert-butyl-1,2-dihydroisoquinoline (CID 155403912) is 3,4-ditert-butyl-1,2-dihydroisoquinoline.
What is the SMILES notation for 3,4-ditert-butyl-1,2-dihydroisoquinoline?
The canonical SMILES for 3,4-ditert-butyl-1,2-dihydroisoquinoline is CC(C)(C)C1=C(C(C)(C)C)c2ccccc2CN1.
What is the InChIKey of 3,4-ditert-butyl-1,2-dihydroisoquinoline?
The InChIKey is ZYVBMRYSYLGAJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N/c1-16(2,3)14-13-10-8-7-9-12(13)11-18-15(14)17(4,5)6/h7-10,18H,11H2,1-6H3.
What are the key properties of 3,4-ditert-butyl-1,2-dihydroisoquinoline?
3,4-ditert-butyl-1,2-dihydroisoquinoline has a molecular weight of 243.39 g/mol, XLogP of 4.59, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butyl-1,2-dihydroisoquinoline is sourced from PubChem (CID 155403912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).