C16H18F5N3O2S — CID 15540410
N-methyl-2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 15540410) has the molecular formula C16H18F5N3O2S and a molecular weight of 411.40 g/mol. Its IUPAC name is N-methyl-2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | N-methyl-2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 15540410 |
| Molecular Formula | C16H18F5N3O2S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-methyl-2-[[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]oxy]-N-(3,3,5-trimethylcyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC1=CC(N(C)C(=O)COc2nnc(C(F)(F)C(F)(F)F)s2)=CC(C)(C)C1 |
| InChI | InChI=1S/C16H18F5N3O2S/c1-9-5-10(7-14(2,3)6-9)24(4)11(25)8-26-13-23-22-12(27-13)15(17,18)16(19,20)21/h5,7H,6,8H2,1-4H3 |
| InChIKey | OKBGVDLWEAEQDX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|