C14H17N3 — CID 155404101
3,3,5,5-tetramethyl-7,8,12-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),7,10,12-pentaene (PubChem CID 155404101) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-7,8,12-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),7,10,12-pentaene.
| Compound Name | 3,3,5,5-tetramethyl-7,8,12-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),7,10,12-pentaene |
|---|---|
| PubChem CID | 155404101 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 3,3,5,5-tetramethyl-7,8,12-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),7,10,12-pentaene |
| SMILES | CC1(C)CC(C)(C)c2c1nnc1ccncc21 |
| InChI | InChI=1S/C14H17N3/c1-13(2)8-14(3,4)12-11(13)9-7-15-6-5-10(9)16-17-12/h5-7H,8H2,1-4H3 |
| InChIKey | PBDUKUNYZAZHFS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |