About 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol
4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol (PubChem CID 155404978) has the molecular formula C7H15N3S
and a molecular weight of 173.28 g/mol. Its IUPAC name is 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol.
Molecular Properties
| Compound Name | 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol |
| PubChem CID | 155404978 |
| Molecular Formula | C7H15N3S |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol |
| SMILES | CN1C=CC(C)(N)N(C)C1S |
| InChI | InChI=1S/C7H15N3S/c1-7(8)4-5-9(2)6(11)10(7)3/h4-6,11H,8H2,1-3H3 |
| InChIKey | LHXJRZIZGNWKOM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol?
The IUPAC name of 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol (CID 155404978) is 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol.
What is the SMILES notation for 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol?
The canonical SMILES for 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol is CN1C=CC(C)(N)N(C)C1S.
What is the InChIKey of 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol?
The InChIKey is LHXJRZIZGNWKOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3S/c1-7(8)4-5-9(2)6(11)10(7)3/h4-6,11H,8H2,1-3H3.
What are the key properties of 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol?
4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol has a molecular weight of 173.28 g/mol, XLogP of 0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,3,4-trimethyl-2H-pyrimidine-2-thiol is sourced from PubChem (CID 155404978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).