About 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine
4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine (PubChem CID 15540531) has the molecular formula C17H18N4O2
and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine.
Molecular Properties
| Compound Name | 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine |
| PubChem CID | 15540531 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine |
| SMILES | CNc1nc(-c2cccc(N)c2)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C17H18N4O2/c1-19-17-20-13-9-15(23-3)14(22-2)8-12(13)16(21-17)10-5-4-6-11(18)7-10/h4-9H,18H2,1-3H3,(H,19,20,21) |
| InChIKey | YZLCPCHEEQPSAS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine?
The IUPAC name of 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine (CID 15540531) is 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine.
What is the SMILES notation for 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine?
The canonical SMILES for 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine is CNc1nc(-c2cccc(N)c2)c2cc(OC)c(OC)cc2n1.
What is the InChIKey of 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine?
The InChIKey is YZLCPCHEEQPSAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O2/c1-19-17-20-13-9-15(23-3)14(22-2)8-12(13)16(21-17)10-5-4-6-11(18)7-10/h4-9H,18H2,1-3H3,(H,19,20,21).
What are the key properties of 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine?
4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine has a molecular weight of 310.36 g/mol, XLogP of 2.94, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-aminophenyl)-6,7-dimethoxy-N-methylquinazolin-2-amine is sourced from PubChem (CID 15540531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).