About N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine
N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine (PubChem CID 155405564) has the molecular formula C19H34N4
and a molecular weight of 318.51 g/mol. Its IUPAC name is N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine |
| PubChem CID | 155405564 |
| Molecular Formula | C19H34N4 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine |
| SMILES | CNCCCN(C)Cc1ccc(N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H34N4/c1-17(2)22-12-14-23(15-13-22)19-8-6-18(7-9-19)16-21(4)11-5-10-20-3/h6-9,17,20H,5,10-16H2,1-4H3 |
| InChIKey | BOFFJDLLFNGUTM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine?
The IUPAC name of N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine (CID 155405564) is N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine.
What is the SMILES notation for N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine?
The canonical SMILES for N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine is CNCCCN(C)Cc1ccc(N2CCN(C(C)C)CC2)cc1.
What is the InChIKey of N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine?
The InChIKey is BOFFJDLLFNGUTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34N4/c1-17(2)22-12-14-23(15-13-22)19-8-6-18(7-9-19)16-21(4)11-5-10-20-3/h6-9,17,20H,5,10-16H2,1-4H3.
What are the key properties of N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine?
N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine has a molecular weight of 318.51 g/mol, XLogP of 2.26, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-N'-[[4-(4-propan-2-ylpiperazin-1-yl)phenyl]methyl]propane-1,3-diamine is sourced from PubChem (CID 155405564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).