C11H20N2O4 — CID 155406049
(3-hydroxy-1,5,5-trimethyl-2-oxo-1,3-diazinan-4-yl) 2-methylpropanoate (PubChem CID 155406049) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3-hydroxy-1,5,5-trimethyl-2-oxo-1,3-diazinan-4-yl) 2-methylpropanoate.
| Compound Name | (3-hydroxy-1,5,5-trimethyl-2-oxo-1,3-diazinan-4-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 155406049 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (3-hydroxy-1,5,5-trimethyl-2-oxo-1,3-diazinan-4-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1N(O)C(=O)N(C)CC1(C)C |
| InChI | InChI=1S/C11H20N2O4/c1-7(2)8(14)17-9-11(3,4)6-12(5)10(15)13(9)16/h7,9,16H,6H2,1-5H3 |
| InChIKey | SZAJDCMDTWSJIO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|