C24H30N4O — CID 155406310
3-[[(2-ethyl-4-pyridinyl)methyl-[(3R)-piperidin-3-yl]amino]methyl]-1-methylquinolin-4-one (PubChem CID 155406310) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[[(2-ethyl-4-pyridinyl)methyl-[(3R)-piperidin-3-yl]amino]methyl]-1-methylquinolin-4-one.
| Compound Name | 3-[[(2-ethyl-4-pyridinyl)methyl-[(3R)-piperidin-3-yl]amino]methyl]-1-methylquinolin-4-one |
|---|---|
| PubChem CID | 155406310 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3-[[(2-ethyl-4-pyridinyl)methyl-[(3R)-piperidin-3-yl]amino]methyl]-1-methylquinolin-4-one |
| SMILES | CCc1cc(CN(Cc2cn(C)c3ccccc3c2=O)[C@@H]2CCCNC2)ccn1 |
| InChI | InChI=1S/C24H30N4O/c1-3-20-13-18(10-12-26-20)15-28(21-7-6-11-25-14-21)17-19-16-27(2)23-9-5-4-8-22(23)24(19)29/h4-5,8-10,12-13,16,21,25H,3,6-7,11,14-15,17H2,1-2H3/t21-/m1/s1 |
| InChIKey | ZACDMMJRXGSSTE-OAQYLSRUSA-N |
| XLogP | 3.25 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |