About (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate
(1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate (PubChem CID 155406449) has the molecular formula C10H16N2O4
and a molecular weight of 228.25 g/mol. Its IUPAC name is (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate.
Molecular Properties
| Compound Name | (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate |
| PubChem CID | 155406449 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate |
| SMILES | CCN1CCC(OC(=O)C2CC2)N(O)C1=O |
| InChI | InChI=1S/C10H16N2O4/c1-2-11-6-5-8(12(15)10(11)14)16-9(13)7-3-4-7/h7-8,15H,2-6H2,1H3 |
| InChIKey | KYSRYCNOTRHMFT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate?
The IUPAC name of (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate (CID 155406449) is (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate.
What is the SMILES notation for (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate?
The canonical SMILES for (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate is CCN1CCC(OC(=O)C2CC2)N(O)C1=O.
What is the InChIKey of (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate?
The InChIKey is KYSRYCNOTRHMFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4/c1-2-11-6-5-8(12(15)10(11)14)16-9(13)7-3-4-7/h7-8,15H,2-6H2,1H3.
What are the key properties of (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate?
(1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate has a molecular weight of 228.25 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethyl-3-hydroxy-2-oxo-1,3-diazinan-4-yl) cyclopropanecarboxylate is sourced from PubChem (CID 155406449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).