C13H20O6 — CID 155407454
methyl (1'R,4R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-carboxylate (PubChem CID 155407454) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl (1'R,4R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-carboxylate.
| Compound Name | methyl (1'R,4R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-carboxylate |
|---|---|
| PubChem CID | 155407454 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | methyl (1'R,4R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@]12OC(OC)C1OC(C)(C)OC12 |
| InChI | InChI=1S/C13H20O6/c1-12(2)17-8-9(18-12)13(19-11(8)16-4)6-5-7(13)10(14)15-3/h7-9,11H,5-6H2,1-4H3/t7-,8?,9?,11?,13+/m0/s1 |
| InChIKey | HCUXEWMKPNZUHN-DVEXXLAHSA-N |
| XLogP | 0.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |