About 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride
2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride (PubChem CID 155407813) has the molecular formula C9H18ClF3N2O
and a molecular weight of 262.70 g/mol. Its IUPAC name is 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride |
| PubChem CID | 155407813 |
| Molecular Formula | C9H18ClF3N2O |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride |
| SMILES | Cl.OCCN(CC(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C9H17F3N2O.ClH/c10-9(11,12)7-14(5-6-15)8-1-3-13-4-2-8;/h8,13,15H,1-7H2;1H |
| InChIKey | QIDNFHOQNXXHLK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride?
The IUPAC name of 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride (CID 155407813) is 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride.
What is the SMILES notation for 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride?
The canonical SMILES for 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride is Cl.OCCN(CC(F)(F)F)C1CCNCC1.
What is the InChIKey of 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride?
The InChIKey is QIDNFHOQNXXHLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O.ClH/c10-9(11,12)7-14(5-6-15)8-1-3-13-4-2-8;/h8,13,15H,1-7H2;1H.
What are the key properties of 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride?
2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride has a molecular weight of 262.70 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[piperidin-4-yl(2,2,2-trifluoroethyl)amino]ethanol;hydrochloride is sourced from PubChem (CID 155407813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).