About N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine
N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine (PubChem CID 155407869) has the molecular formula C11H18FN3O
and a molecular weight of 227.28 g/mol. Its IUPAC name is N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine |
| PubChem CID | 155407869 |
| Molecular Formula | C11H18FN3O |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine |
| SMILES | FCCN(Cc1cnco1)C1CCNCC1 |
| InChI | InChI=1S/C11H18FN3O/c12-3-6-15(8-11-7-14-9-16-11)10-1-4-13-5-2-10/h7,9-10,13H,1-6,8H2 |
| InChIKey | OZVSLBNUKPEKHS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine?
The IUPAC name of N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine (CID 155407869) is N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine.
What is the SMILES notation for N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine?
The canonical SMILES for N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine is FCCN(Cc1cnco1)C1CCNCC1.
What is the InChIKey of N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine?
The InChIKey is OZVSLBNUKPEKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FN3O/c12-3-6-15(8-11-7-14-9-16-11)10-1-4-13-5-2-10/h7,9-10,13H,1-6,8H2.
What are the key properties of N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine?
N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine has a molecular weight of 227.28 g/mol, XLogP of 1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-N-(1,3-oxazol-5-ylmethyl)piperidin-4-amine is sourced from PubChem (CID 155407869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).