About phosphonooxymethyl 2-butyloctanoate
phosphonooxymethyl 2-butyloctanoate (PubChem CID 155408275) has the molecular formula C13H27O6P
and a molecular weight of 310.33 g/mol. Its IUPAC name is phosphonooxymethyl 2-butyloctanoate.
Molecular Properties
| Compound Name | phosphonooxymethyl 2-butyloctanoate |
| PubChem CID | 155408275 |
| Molecular Formula | C13H27O6P |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | phosphonooxymethyl 2-butyloctanoate |
| SMILES | CCCCCCC(CCCC)C(=O)OCOP(=O)(O)O |
| InChI | InChI=1S/C13H27O6P/c1-3-5-7-8-10-12(9-6-4-2)13(14)18-11-19-20(15,16)17/h12H,3-11H2,1-2H3,(H2,15,16,17) |
| InChIKey | URBWBGZVVQWRAZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphonooxymethyl 2-butyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphonooxymethyl 2-butyloctanoate?
The IUPAC name of phosphonooxymethyl 2-butyloctanoate (CID 155408275) is phosphonooxymethyl 2-butyloctanoate.
What is the SMILES notation for phosphonooxymethyl 2-butyloctanoate?
The canonical SMILES for phosphonooxymethyl 2-butyloctanoate is CCCCCCC(CCCC)C(=O)OCOP(=O)(O)O.
What is the InChIKey of phosphonooxymethyl 2-butyloctanoate?
The InChIKey is URBWBGZVVQWRAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27O6P/c1-3-5-7-8-10-12(9-6-4-2)13(14)18-11-19-20(15,16)17/h12H,3-11H2,1-2H3,(H2,15,16,17).
What are the key properties of phosphonooxymethyl 2-butyloctanoate?
phosphonooxymethyl 2-butyloctanoate has a molecular weight of 310.33 g/mol, XLogP of 3.37, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phosphonooxymethyl 2-butyloctanoate is sourced from PubChem (CID 155408275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).